About 2-phenylfuro[2,3-d]pyridazine
2-phenylfuro[2,3-d]pyridazine (PubChem CID 150815215) has the molecular formula C12H8N2O
and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-phenylfuro[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 2-phenylfuro[2,3-d]pyridazine |
| PubChem CID | 150815215 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 2-phenylfuro[2,3-d]pyridazine |
| SMILES | c1ccc(-c2cc3cnncc3o2)cc1 |
| InChI | InChI=1S/C12H8N2O/c1-2-4-9(5-3-1)11-6-10-7-13-14-8-12(10)15-11/h1-8H |
| InChIKey | KISRDZDNCOCAAN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylfuro[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylfuro[2,3-d]pyridazine?
The IUPAC name of 2-phenylfuro[2,3-d]pyridazine (CID 150815215) is 2-phenylfuro[2,3-d]pyridazine.
What is the SMILES notation for 2-phenylfuro[2,3-d]pyridazine?
The canonical SMILES for 2-phenylfuro[2,3-d]pyridazine is c1ccc(-c2cc3cnncc3o2)cc1.
What is the InChIKey of 2-phenylfuro[2,3-d]pyridazine?
The InChIKey is KISRDZDNCOCAAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O/c1-2-4-9(5-3-1)11-6-10-7-13-14-8-12(10)15-11/h1-8H.
What are the key properties of 2-phenylfuro[2,3-d]pyridazine?
2-phenylfuro[2,3-d]pyridazine has a molecular weight of 196.21 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylfuro[2,3-d]pyridazine is sourced from PubChem (CID 150815215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).