C31H30FN7O3 — CID 150815931
4-anilino-6-[4-(4-azidobutylcarbamoyl)-3-fluorophenyl]-N-cyclopropyl-7-methoxyquinoline-3-carboxamide (PubChem CID 150815931) has the molecular formula C31H30FN7O3 and a molecular weight of 567.63 g/mol. Its IUPAC name is 4-anilino-6-[4-(4-azidobutylcarbamoyl)-3-fluorophenyl]-N-cyclopropyl-7-methoxyquinoline-3-carboxamide.
| Compound Name | 4-anilino-6-[4-(4-azidobutylcarbamoyl)-3-fluorophenyl]-N-cyclopropyl-7-methoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 150815931 |
| Molecular Formula | C31H30FN7O3 |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | 4-anilino-6-[4-(4-azidobutylcarbamoyl)-3-fluorophenyl]-N-cyclopropyl-7-methoxyquinoline-3-carboxamide |
| SMILES | COc1cc2ncc(C(=O)NC3CC3)c(Nc3ccccc3)c2cc1-c1ccc(C(=O)NCCCCN=[N+]=[N-])c(F)c1 |
| InChI | InChI=1S/C31H30FN7O3/c1-42-28-17-27-24(29(37-20-7-3-2-4-8-20)25(18-35-27)31(41)38-21-10-11-21)16-23(28)19-9-12-22(26(32)15-19)30(40)34-13-5-6-14-36-39-33/h2-4,7-9,12,15-18,21H,5-6,10-11,13-14H2,1H3,(H,34,40)(H,35,37)(H,38,41) |
| InChIKey | KIWQYPBKAJCATK-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|