C16H21NO3S — CID 150817477
methyl (2R,4R,5R)-2-tert-butyl-3-formyl-5-phenyl-1,3-thiazolidine-4-carboxylate (PubChem CID 150817477) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is methyl (2R,4R,5R)-2-tert-butyl-3-formyl-5-phenyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (2R,4R,5R)-2-tert-butyl-3-formyl-5-phenyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 150817477 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | methyl (2R,4R,5R)-2-tert-butyl-3-formyl-5-phenyl-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccccc2)S[C@H](C(C)(C)C)N1C=O |
| InChI | InChI=1S/C16H21NO3S/c1-16(2,3)15-17(10-18)12(14(19)20-4)13(21-15)11-8-6-5-7-9-11/h5-10,12-13,15H,1-4H3/t12-,13+,15+/m0/s1 |
| InChIKey | KJEUVVRWXOQSHM-GZBFAFLISA-N |
| XLogP | 2.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|