About CID 150820169
CID 150820169 (PubChem CID 150820169) has the molecular formula C38H46Zr
and a molecular weight of 594.01 g/mol.
Molecular Properties
| Compound Name | CID 150820169 |
| PubChem CID | 150820169 |
| Molecular Formula | C38H46Zr |
| Molecular Weight | 594.01 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C1=[C-]C(C)(C)c2cc3c(cc21)-c1cc2c(cc1C3)C(C)(C)C=C2C(C)(C)C.Cc1c[cH-]c(C)c1.[Zr+2] |
| InChI | InChI=1S/C31H37.C7H9.Zr/c1-28(2,3)26-16-30(7,8)24-12-18-11-19-13-25-23(15-21(19)20(18)14-22(24)26)27(29(4,5)6)17-31(25,9)10;1-6-3-4-7(2)5-6;/h12-16H,11H2,1-10H3;3-5H,1-2H3;/q2*-1;+2 |
| InChIKey | KJTHEVIKVHEAJX-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 594.01 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 150820169 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 150820169?
The IUPAC name of CID 150820169 (CID 150820169) is not available.
What is the SMILES notation for CID 150820169?
The canonical SMILES for CID 150820169 is CC(C)(C)C1=[C-]C(C)(C)c2cc3c(cc21)-c1cc2c(cc1C3)C(C)(C)C=C2C(C)(C)C.Cc1c[cH-]c(C)c1.[Zr+2].
What is the InChIKey of CID 150820169?
The InChIKey is KJTHEVIKVHEAJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H37.C7H9.Zr/c1-28(2,3)26-16-30(7,8)24-12-18-11-19-13-25-23(15-21(19)20(18)14-22(24)26)27(29(4,5)6)17-31(25,9)10;1-6-3-4-7(2)5-6;/h12-16H,11H2,1-10H3;3-5H,1-2H3;/q2*-1;+2.
What are the key properties of CID 150820169?
CID 150820169 has a molecular weight of 594.01 g/mol, XLogP of 10.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 150820169 is sourced from PubChem (CID 150820169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).