C20H9BrF9N2O3S- — CID 150824134
N-[2-bromo-6-(difluoromethylsulfinyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-oxidoquinoline-7-carboxamide (PubChem CID 150824134) has the molecular formula C20H9BrF9N2O3S- and a molecular weight of 608.26 g/mol. Its IUPAC name is N-[2-bromo-6-(difluoromethylsulfinyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-oxidoquinoline-7-carboxamide.
| Compound Name | N-[2-bromo-6-(difluoromethylsulfinyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-oxidoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 150824134 |
| Molecular Formula | C20H9BrF9N2O3S- |
| Molecular Weight | 608.26 g/mol |
| Exact Mass | 606.94 |
| IUPAC Name | N-[2-bromo-6-(difluoromethylsulfinyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-oxidoquinoline-7-carboxamide |
| SMILES | O=C(c1ccc2cccnc2c1)N([O-])c1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1S(=O)C(F)F |
| InChI | InChI=1S/C20H9BrF9N2O3S/c21-12-7-11(18(24,19(25,26)27)20(28,29)30)8-14(36(35)17(22)23)15(12)32(34)16(33)10-4-3-9-2-1-5-31-13(9)6-10/h1-8,17H/q-1 |
| InChIKey | XVHDNQMGZWFKPI-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.26 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|