About 2-tert-butyl-5,6-dihydroindeno[2,1-b]indole
2-tert-butyl-5,6-dihydroindeno[2,1-b]indole (PubChem CID 15082753) has the molecular formula C19H19N
and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-tert-butyl-5,6-dihydroindeno[2,1-b]indole.
Molecular Properties
| Compound Name | 2-tert-butyl-5,6-dihydroindeno[2,1-b]indole |
| PubChem CID | 15082753 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-tert-butyl-5,6-dihydroindeno[2,1-b]indole |
| SMILES | CC(C)(C)c1ccc2[nH]c3c(c2c1)-c1ccccc1C3 |
| InChI | InChI=1S/C19H19N/c1-19(2,3)13-8-9-16-15(11-13)18-14-7-5-4-6-12(14)10-17(18)20-16/h4-9,11,20H,10H2,1-3H3 |
| InChIKey | XAAOBNZRGNETLM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-5,6-dihydroindeno[2,1-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5,6-dihydroindeno[2,1-b]indole?
The IUPAC name of 2-tert-butyl-5,6-dihydroindeno[2,1-b]indole (CID 15082753) is 2-tert-butyl-5,6-dihydroindeno[2,1-b]indole.
What is the SMILES notation for 2-tert-butyl-5,6-dihydroindeno[2,1-b]indole?
The canonical SMILES for 2-tert-butyl-5,6-dihydroindeno[2,1-b]indole is CC(C)(C)c1ccc2[nH]c3c(c2c1)-c1ccccc1C3.
What is the InChIKey of 2-tert-butyl-5,6-dihydroindeno[2,1-b]indole?
The InChIKey is XAAOBNZRGNETLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N/c1-19(2,3)13-8-9-16-15(11-13)18-14-7-5-4-6-12(14)10-17(18)20-16/h4-9,11,20H,10H2,1-3H3.
What are the key properties of 2-tert-butyl-5,6-dihydroindeno[2,1-b]indole?
2-tert-butyl-5,6-dihydroindeno[2,1-b]indole has a molecular weight of 261.37 g/mol, XLogP of 5.04, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5,6-dihydroindeno[2,1-b]indole is sourced from PubChem (CID 15082753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).