C24H27N3O3 — CID 150827658
butyl 2-[3-[[(4-pyrimidin-5-ylphenyl)methylamino]methyl]phenoxy]acetate (PubChem CID 150827658) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is butyl 2-[3-[[(4-pyrimidin-5-ylphenyl)methylamino]methyl]phenoxy]acetate.
| Compound Name | butyl 2-[3-[[(4-pyrimidin-5-ylphenyl)methylamino]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 150827658 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | butyl 2-[3-[[(4-pyrimidin-5-ylphenyl)methylamino]methyl]phenoxy]acetate |
| SMILES | CCCCOC(=O)COc1cccc(CNCc2ccc(-c3cncnc3)cc2)c1 |
| InChI | InChI=1S/C24H27N3O3/c1-2-3-11-29-24(28)17-30-23-6-4-5-20(12-23)14-25-13-19-7-9-21(10-8-19)22-15-26-18-27-16-22/h4-10,12,15-16,18,25H,2-3,11,13-14,17H2,1H3 |
| InChIKey | KLGQTHVEXRIEEJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|