C17H32N8O2 — CID 150830722
(2S)-2-[[[4-(4-azidobutanoyl)piperazin-1-yl]-(dimethylamino)methylidene]amino]-N,3-dimethylbutanamide (PubChem CID 150830722) has the molecular formula C17H32N8O2 and a molecular weight of 380.50 g/mol. Its IUPAC name is (2S)-2-[[[4-(4-azidobutanoyl)piperazin-1-yl]-(dimethylamino)methylidene]amino]-N,3-dimethylbutanamide.
| Compound Name | (2S)-2-[[[4-(4-azidobutanoyl)piperazin-1-yl]-(dimethylamino)methylidene]amino]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 150830722 |
| Molecular Formula | C17H32N8O2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (2S)-2-[[[4-(4-azidobutanoyl)piperazin-1-yl]-(dimethylamino)methylidene]amino]-N,3-dimethylbutanamide |
| SMILES | CNC(=O)[C@@H](/N=C(\N(C)C)N1CCN(C(=O)CCCN=[N+]=[N-])CC1)C(C)C |
| InChI | InChI=1S/C17H32N8O2/c1-13(2)15(16(27)19-3)21-17(23(4)5)25-11-9-24(10-12-25)14(26)7-6-8-20-22-18/h13,15H,6-12H2,1-5H3,(H,19,27)/b21-17+/t15-/m0/s1 |
| InChIKey | KLXHWXFHFUSODH-OSGFXRFRSA-N |
| XLogP | 0.91 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|