C13H15BrF2N2O3 — CID 150831157
4-[(2-bromo-5,5-difluoro-4-methoxypentanoyl)amino]benzamide (PubChem CID 150831157) has the molecular formula C13H15BrF2N2O3 and a molecular weight of 365.17 g/mol. Its IUPAC name is 4-[(2-bromo-5,5-difluoro-4-methoxypentanoyl)amino]benzamide.
| Compound Name | 4-[(2-bromo-5,5-difluoro-4-methoxypentanoyl)amino]benzamide |
|---|---|
| PubChem CID | 150831157 |
| Molecular Formula | C13H15BrF2N2O3 |
| Molecular Weight | 365.17 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 4-[(2-bromo-5,5-difluoro-4-methoxypentanoyl)amino]benzamide |
| SMILES | COC(CC(Br)C(=O)Nc1ccc(C(N)=O)cc1)C(F)F |
| InChI | InChI=1S/C13H15BrF2N2O3/c1-21-10(11(15)16)6-9(14)13(20)18-8-4-2-7(3-5-8)12(17)19/h2-5,9-11H,6H2,1H3,(H2,17,19)(H,18,20) |
| InChIKey | KLZMSGWUFVMJGO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|