C11H22O3 — CID 150831609
2,6-dihydroxy-2,3,5,6-tetramethylheptan-4-one (PubChem CID 150831609) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 2,6-dihydroxy-2,3,5,6-tetramethylheptan-4-one.
| Compound Name | 2,6-dihydroxy-2,3,5,6-tetramethylheptan-4-one |
|---|---|
| PubChem CID | 150831609 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2,6-dihydroxy-2,3,5,6-tetramethylheptan-4-one |
| SMILES | CC(C(=O)C(C)C(C)(C)O)C(C)(C)O |
| InChI | InChI=1S/C11H22O3/c1-7(10(3,4)13)9(12)8(2)11(5,6)14/h7-8,13-14H,1-6H3 |
| InChIKey | KMBWTUYIRQKWEG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |