C18H28O2 — CID 150834881
(8R,9R,10S,13R,14S)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-13-carboxylic acid (PubChem CID 150834881) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (8R,9R,10S,13R,14S)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-13-carboxylic acid.
| Compound Name | (8R,9R,10S,13R,14S)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-13-carboxylic acid |
|---|---|
| PubChem CID | 150834881 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (8R,9R,10S,13R,14S)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-13-carboxylic acid |
| SMILES | O=C(O)[C@@]12CCC[C@H]1[C@@H]1CCC3CCCC[C@@H]3[C@H]1CC2 |
| InChI | InChI=1S/C18H28O2/c19-17(20)18-10-3-6-16(18)15-8-7-12-4-1-2-5-13(12)14(15)9-11-18/h12-16H,1-11H2,(H,19,20)/t12?,13-,14+,15+,16-,18+/m0/s1 |
| InChIKey | KMTOVFYPXQHDNL-ZLNKDHKMSA-N |
| XLogP | 4.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |