About (propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate
(propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate (PubChem CID 150837696) has the molecular formula C8H11NO3S
and a molecular weight of 201.25 g/mol. Its IUPAC name is (propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate.
Molecular Properties
| Compound Name | (propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate |
| PubChem CID | 150837696 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | (propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate |
| SMILES | CC(C)=NOS(=O)(=O)C1=CC=CC1 |
| InChI | InChI=1S/C8H11NO3S/c1-7(2)9-12-13(10,11)8-5-3-4-6-8/h3-5H,6H2,1-2H3 |
| InChIKey | KNIHZSHARUBEHB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate?
The IUPAC name of (propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate (CID 150837696) is (propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate.
What is the SMILES notation for (propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate?
The canonical SMILES for (propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate is CC(C)=NOS(=O)(=O)C1=CC=CC1.
What is the InChIKey of (propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate?
The InChIKey is KNIHZSHARUBEHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3S/c1-7(2)9-12-13(10,11)8-5-3-4-6-8/h3-5H,6H2,1-2H3.
What are the key properties of (propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate?
(propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate has a molecular weight of 201.25 g/mol, XLogP of 1.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-ylideneamino) cyclopenta-1,3-diene-1-sulfonate is sourced from PubChem (CID 150837696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).