C16H28N6O3 — CID 150838188
(2R,3S,5R)-5-[6-amino-6-(hexylamino)-8H-purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 150838188) has the molecular formula C16H28N6O3 and a molecular weight of 352.44 g/mol. Its IUPAC name is (2R,3S,5R)-5-[6-amino-6-(hexylamino)-8H-purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-[6-amino-6-(hexylamino)-8H-purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 150838188 |
| Molecular Formula | C16H28N6O3 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (2R,3S,5R)-5-[6-amino-6-(hexylamino)-8H-purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CCCCCCNC1(N)N=CN=C2C1=NCN2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C16H28N6O3/c1-2-3-4-5-6-20-16(17)14-15(18-9-21-16)22(10-19-14)13-7-11(24)12(8-23)25-13/h9,11-13,20,23-24H,2-8,10,17H2,1H3/t11-,12+,13+,16?/m0/s1 |
| InChIKey | KNKRSUPDHTUOIW-NXBSNPICSA-N |
| XLogP | -0.61 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|