C21H27N — CID 150838395
2,2,6,6-tetramethyl-4-(2-phenylphenyl)piperidine (PubChem CID 150838395) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-(2-phenylphenyl)piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-(2-phenylphenyl)piperidine |
|---|---|
| PubChem CID | 150838395 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-(2-phenylphenyl)piperidine |
| SMILES | CC1(C)CC(c2ccccc2-c2ccccc2)CC(C)(C)N1 |
| InChI | InChI=1S/C21H27N/c1-20(2)14-17(15-21(3,4)22-20)19-13-9-8-12-18(19)16-10-6-5-7-11-16/h5-13,17,22H,14-15H2,1-4H3 |
| InChIKey | KNLUTRWWGANOGI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |