C25H27F2NO4 — CID 150838563
(7S,8aS)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-3,10-dioxo-7-propan-2-yl-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide (PubChem CID 150838563) has the molecular formula C25H27F2NO4 and a molecular weight of 443.49 g/mol. Its IUPAC name is (7S,8aS)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-3,10-dioxo-7-propan-2-yl-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide.
| Compound Name | (7S,8aS)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-3,10-dioxo-7-propan-2-yl-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
|---|---|
| PubChem CID | 150838563 |
| Molecular Formula | C25H27F2NO4 |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (7S,8aS)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-3,10-dioxo-7-propan-2-yl-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
| SMILES | CC(C)[C@H]1CCC2C(=O)C3=C(C=C(C(=O)NCc4ccc(F)cc4F)C(=O)C3O)C[C@@H]2C1 |
| InChI | InChI=1S/C25H27F2NO4/c1-12(2)13-4-6-18-15(7-13)8-16-9-19(23(30)24(31)21(16)22(18)29)25(32)28-11-14-3-5-17(26)10-20(14)27/h3,5,9-10,12-13,15,18,24,31H,4,6-8,11H2,1-2H3,(H,28,32)/t13-,15-,18?,24?/m0/s1 |
| InChIKey | KNMRHHVSBCJBIJ-VRNMKCOZSA-N |
| XLogP | 3.41 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|