About 6H-azepino[4,3-b]indol-1-one
6H-azepino[4,3-b]indol-1-one (PubChem CID 150838998) has the molecular formula C12H8N2O
and a molecular weight of 196.21 g/mol. Its IUPAC name is 6H-azepino[4,3-b]indol-1-one.
Molecular Properties
| Compound Name | 6H-azepino[4,3-b]indol-1-one |
| PubChem CID | 150838998 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 6H-azepino[4,3-b]indol-1-one |
| SMILES | O=c1ncccc2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C12H8N2O/c15-12-11-8-4-1-2-5-9(8)14-10(11)6-3-7-13-12/h1-7,14H |
| InChIKey | LHVTTXNFFKRCFI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6H-azepino[4,3-b]indol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-azepino[4,3-b]indol-1-one?
The IUPAC name of 6H-azepino[4,3-b]indol-1-one (CID 150838998) is 6H-azepino[4,3-b]indol-1-one.
What is the SMILES notation for 6H-azepino[4,3-b]indol-1-one?
The canonical SMILES for 6H-azepino[4,3-b]indol-1-one is O=c1ncccc2[nH]c3ccccc3c12.
What is the InChIKey of 6H-azepino[4,3-b]indol-1-one?
The InChIKey is LHVTTXNFFKRCFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O/c15-12-11-8-4-1-2-5-9(8)14-10(11)6-3-7-13-12/h1-7,14H.
What are the key properties of 6H-azepino[4,3-b]indol-1-one?
6H-azepino[4,3-b]indol-1-one has a molecular weight of 196.21 g/mol, XLogP of 2.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-azepino[4,3-b]indol-1-one is sourced from PubChem (CID 150838998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).