About (8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate
(8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate (PubChem CID 150839732) has the molecular formula C18H24O5
and a molecular weight of 320.38 g/mol. Its IUPAC name is (8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate.
Molecular Properties
| Compound Name | (8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate |
| PubChem CID | 150839732 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1COCCC(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C18H24O5/c1-13(2)18(20)23-16-12-21-9-8-17(19)22-11-15(16)10-14-6-4-3-5-7-14/h3-7,13,15-16H,8-12H2,1-2H3 |
| InChIKey | KNSPYTKRZZXVDB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate?
The IUPAC name of (8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate (CID 150839732) is (8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate.
What is the SMILES notation for (8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate?
The canonical SMILES for (8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate is CC(C)C(=O)OC1COCCC(=O)OCC1Cc1ccccc1.
What is the InChIKey of (8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate?
The InChIKey is KNSPYTKRZZXVDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O5/c1-13(2)18(20)23-16-12-21-9-8-17(19)22-11-15(16)10-14-6-4-3-5-7-14/h3-7,13,15-16H,8-12H2,1-2H3.
What are the key properties of (8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate?
(8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate has a molecular weight of 320.38 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (8-benzyl-2-oxo-1,5-dioxonan-7-yl) 2-methylpropanoate is sourced from PubChem (CID 150839732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).