C31H31N5O4S — CID 150841143
ethyl 2-[[2-[2-(4-aminophenyl)ethyl]-1-cyclopropylbenzimidazol-5-yl]-quinolin-8-ylsulfonylamino]acetate (PubChem CID 150841143) has the molecular formula C31H31N5O4S and a molecular weight of 569.69 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(4-aminophenyl)ethyl]-1-cyclopropylbenzimidazol-5-yl]-quinolin-8-ylsulfonylamino]acetate.
| Compound Name | ethyl 2-[[2-[2-(4-aminophenyl)ethyl]-1-cyclopropylbenzimidazol-5-yl]-quinolin-8-ylsulfonylamino]acetate |
|---|---|
| PubChem CID | 150841143 |
| Molecular Formula | C31H31N5O4S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | ethyl 2-[[2-[2-(4-aminophenyl)ethyl]-1-cyclopropylbenzimidazol-5-yl]-quinolin-8-ylsulfonylamino]acetate |
| SMILES | CCOC(=O)CN(c1ccc2c(c1)nc(CCc1ccc(N)cc1)n2C1CC1)S(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C31H31N5O4S/c1-2-40-30(37)20-35(41(38,39)28-7-3-5-22-6-4-18-33-31(22)28)25-15-16-27-26(19-25)34-29(36(27)24-13-14-24)17-10-21-8-11-23(32)12-9-21/h3-9,11-12,15-16,18-19,24H,2,10,13-14,17,20,32H2,1H3 |
| InChIKey | KNZZKZHZUYXOIS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 120.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|