C25H17ClN4OS — CID 15084150
7-(2-chlorophenyl)-4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethynyl]-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 15084150) has the molecular formula C25H17ClN4OS and a molecular weight of 456.96 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethynyl]-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 7-(2-chlorophenyl)-4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethynyl]-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 15084150 |
| Molecular Formula | C25H17ClN4OS |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 7-(2-chlorophenyl)-4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethynyl]-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1nnc2n1-c1sc(C#Cc3ccc4c(c3)CCO4)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C25H17ClN4OS/c1-15-28-29-23-14-27-24(19-4-2-3-5-21(19)26)20-13-18(32-25(20)30(15)23)8-6-16-7-9-22-17(12-16)10-11-31-22/h2-5,7,9,12-13H,10-11,14H2,1H3 |
| InChIKey | OHDKJLCMZRMSHN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|