C28H23ClN4OS — CID 15084151
7-(2-chlorophenyl)-13-methyl-4-[2-(2,2,7-trimethyl-3H-1-benzofuran-5-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 15084151) has the molecular formula C28H23ClN4OS and a molecular weight of 499.04 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-13-methyl-4-[2-(2,2,7-trimethyl-3H-1-benzofuran-5-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 7-(2-chlorophenyl)-13-methyl-4-[2-(2,2,7-trimethyl-3H-1-benzofuran-5-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 15084151 |
| Molecular Formula | C28H23ClN4OS |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 7-(2-chlorophenyl)-13-methyl-4-[2-(2,2,7-trimethyl-3H-1-benzofuran-5-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1cc(C#Cc2cc3c(s2)-n2c(C)nnc2CN=C3c2ccccc2Cl)cc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C28H23ClN4OS/c1-16-11-18(12-19-14-28(3,4)34-26(16)19)9-10-20-13-22-25(21-7-5-6-8-23(21)29)30-15-24-32-31-17(2)33(24)27(22)35-20/h5-8,11-13H,14-15H2,1-4H3 |
| InChIKey | ZPNHTHYJDXMSOP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|