C26H16ClN5S2 — CID 15084152
7-(2-chlorophenyl)-13-methyl-4-[2-(5-pyridin-2-ylthiophen-2-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 15084152) has the molecular formula C26H16ClN5S2 and a molecular weight of 498.04 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-13-methyl-4-[2-(5-pyridin-2-ylthiophen-2-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 7-(2-chlorophenyl)-13-methyl-4-[2-(5-pyridin-2-ylthiophen-2-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 15084152 |
| Molecular Formula | C26H16ClN5S2 |
| Molecular Weight | 498.04 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | 7-(2-chlorophenyl)-13-methyl-4-[2-(5-pyridin-2-ylthiophen-2-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1nnc2n1-c1sc(C#Cc3ccc(-c4ccccn4)s3)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C26H16ClN5S2/c1-16-30-31-24-15-29-25(19-6-2-3-7-21(19)27)20-14-18(34-26(20)32(16)24)10-9-17-11-12-23(33-17)22-8-4-5-13-28-22/h2-8,11-14H,15H2,1H3 |
| InChIKey | YABUSIXMDKQDQO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.04 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|