C29H29ClN4S — CID 15084157
7-(2-chlorophenyl)-4-[2-(4-cyclohexylphenyl)ethyl]-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 15084157) has the molecular formula C29H29ClN4S and a molecular weight of 501.10 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-4-[2-(4-cyclohexylphenyl)ethyl]-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 7-(2-chlorophenyl)-4-[2-(4-cyclohexylphenyl)ethyl]-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 15084157 |
| Molecular Formula | C29H29ClN4S |
| Molecular Weight | 501.10 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 7-(2-chlorophenyl)-4-[2-(4-cyclohexylphenyl)ethyl]-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1nnc2n1-c1sc(CCc3ccc(C4CCCCC4)cc3)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C29H29ClN4S/c1-19-32-33-27-18-31-28(24-9-5-6-10-26(24)30)25-17-23(35-29(25)34(19)27)16-13-20-11-14-22(15-12-20)21-7-3-2-4-8-21/h5-6,9-12,14-15,17,21H,2-4,7-8,13,16,18H2,1H3 |
| InChIKey | KVEJKTJWEFXFDT-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.10 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |