C14H24O2 — CID 15084211
[(3E)-dodeca-1,3-dien-5-yl] acetate (PubChem CID 15084211) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is [(3E)-dodeca-1,3-dien-5-yl] acetate.
| Compound Name | [(3E)-dodeca-1,3-dien-5-yl] acetate |
|---|---|
| PubChem CID | 15084211 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | [(3E)-dodeca-1,3-dien-5-yl] acetate |
| SMILES | C=C/C=C/C(CCCCCCC)OC(C)=O |
| InChI | InChI=1S/C14H24O2/c1-4-6-8-9-10-12-14(11-7-5-2)16-13(3)15/h5,7,11,14H,2,4,6,8-10,12H2,1,3H3/b11-7+ |
| InChIKey | SSRARWGATREGCF-YRNVUSSQSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|