About 2-methylthian-3-amine
2-methylthian-3-amine (PubChem CID 15084370) has the molecular formula C6H13NS
and a molecular weight of 131.24 g/mol. Its IUPAC name is 2-methylthian-3-amine.
Molecular Properties
| Compound Name | 2-methylthian-3-amine |
| PubChem CID | 15084370 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | 2-methylthian-3-amine |
| SMILES | CC1SCCCC1N |
| InChI | InChI=1S/C6H13NS/c1-5-6(7)3-2-4-8-5/h5-6H,2-4,7H2,1H3 |
| InChIKey | NUBRNGDJEVPKTA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylthian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylthian-3-amine?
The IUPAC name of 2-methylthian-3-amine (CID 15084370) is 2-methylthian-3-amine.
What is the SMILES notation for 2-methylthian-3-amine?
The canonical SMILES for 2-methylthian-3-amine is CC1SCCCC1N.
What is the InChIKey of 2-methylthian-3-amine?
The InChIKey is NUBRNGDJEVPKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NS/c1-5-6(7)3-2-4-8-5/h5-6H,2-4,7H2,1H3.
What are the key properties of 2-methylthian-3-amine?
2-methylthian-3-amine has a molecular weight of 131.24 g/mol, XLogP of 1.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylthian-3-amine is sourced from PubChem (CID 15084370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).