C10H16N2O4 — CID 150845253
5-(2-hydroxypropan-2-yl)-2-(1-methoxyethyl)-1H-imidazole-4-carboxylic acid (PubChem CID 150845253) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 5-(2-hydroxypropan-2-yl)-2-(1-methoxyethyl)-1H-imidazole-4-carboxylic acid.
| Compound Name | 5-(2-hydroxypropan-2-yl)-2-(1-methoxyethyl)-1H-imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 150845253 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 5-(2-hydroxypropan-2-yl)-2-(1-methoxyethyl)-1H-imidazole-4-carboxylic acid |
| SMILES | COC(C)c1nc(C(=O)O)c(C(C)(C)O)[nH]1 |
| InChI | InChI=1S/C10H16N2O4/c1-5(16-4)8-11-6(9(13)14)7(12-8)10(2,3)15/h5,15H,1-4H3,(H,11,12)(H,13,14) |
| InChIKey | KOVWSDQOOLGWQN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |