C11H15F3N2O2 — CID 150845366
ethyl 5-(2-methylpropyl)-3-(trifluoromethyl)-1H-pyrazole-4-carboxylate (PubChem CID 150845366) has the molecular formula C11H15F3N2O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is ethyl 5-(2-methylpropyl)-3-(trifluoromethyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(2-methylpropyl)-3-(trifluoromethyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 150845366 |
| Molecular Formula | C11H15F3N2O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | ethyl 5-(2-methylpropyl)-3-(trifluoromethyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)(F)F)n[nH]c1CC(C)C |
| InChI | InChI=1S/C11H15F3N2O2/c1-4-18-10(17)8-7(5-6(2)3)15-16-9(8)11(12,13)14/h6H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | KOWNIDLJTUCWOT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |