C18H18ClN3O4 — CID 150845378
2-[[2-[2-acetyl-5-(aminomethyl)-4-chloroanilino]acetyl]amino]benzoic acid (PubChem CID 150845378) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is 2-[[2-[2-acetyl-5-(aminomethyl)-4-chloroanilino]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[2-acetyl-5-(aminomethyl)-4-chloroanilino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 150845378 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-[[2-[2-acetyl-5-(aminomethyl)-4-chloroanilino]acetyl]amino]benzoic acid |
| SMILES | CC(=O)c1cc(Cl)c(CN)cc1NCC(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C18H18ClN3O4/c1-10(23)13-7-14(19)11(8-20)6-16(13)21-9-17(24)22-15-5-3-2-4-12(15)18(25)26/h2-7,21H,8-9,20H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | KOWPBFFKKPKNRC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |