C32H25Cl2FN2O3S2 — CID 150846397
(E)-N-(4,5-dichlorothiophen-2-yl)sulfonyl-3-[3-fluoro-9-[(4-phenylphenyl)methyl]-5,6,7,8-tetrahydrocarbazol-1-yl]prop-2-enamide (PubChem CID 150846397) has the molecular formula C32H25Cl2FN2O3S2 and a molecular weight of 639.60 g/mol. Its IUPAC name is (E)-N-(4,5-dichlorothiophen-2-yl)sulfonyl-3-[3-fluoro-9-[(4-phenylphenyl)methyl]-5,6,7,8-tetrahydrocarbazol-1-yl]prop-2-enamide.
| Compound Name | (E)-N-(4,5-dichlorothiophen-2-yl)sulfonyl-3-[3-fluoro-9-[(4-phenylphenyl)methyl]-5,6,7,8-tetrahydrocarbazol-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 150846397 |
| Molecular Formula | C32H25Cl2FN2O3S2 |
| Molecular Weight | 639.60 g/mol |
| Exact Mass | 638.07 |
| IUPAC Name | (E)-N-(4,5-dichlorothiophen-2-yl)sulfonyl-3-[3-fluoro-9-[(4-phenylphenyl)methyl]-5,6,7,8-tetrahydrocarbazol-1-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(F)cc2c3c(n(Cc4ccc(-c5ccccc5)cc4)c12)CCCC3)NS(=O)(=O)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C32H25Cl2FN2O3S2/c33-27-18-30(41-32(27)34)42(39,40)36-29(38)15-14-23-16-24(35)17-26-25-8-4-5-9-28(25)37(31(23)26)19-20-10-12-22(13-11-20)21-6-2-1-3-7-21/h1-3,6-7,10-18H,4-5,8-9,19H2,(H,36,38)/b15-14+ |
| InChIKey | KPCATLNLSBBLPY-CCEZHUSRSA-N |
| XLogP | 8.26 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.60 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|