C3H2F5O3S- — CID 150848433
1,1,2,2,2-pentafluoroethylsulfonylmethanolate (PubChem CID 150848433) has the molecular formula C3H2F5O3S- and a molecular weight of 213.10 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethylsulfonylmethanolate.
| Compound Name | 1,1,2,2,2-pentafluoroethylsulfonylmethanolate |
|---|---|
| PubChem CID | 150848433 |
| Molecular Formula | C3H2F5O3S- |
| Molecular Weight | 213.10 g/mol |
| Exact Mass | 212.97 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethylsulfonylmethanolate |
| SMILES | O=S(=O)(C[O-])C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C3H2F5O3S/c4-2(5,6)3(7,8)12(10,11)1-9/h1H2/q-1 |
| InChIKey | KPMXUERWWPNOPQ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.10 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|