C18H31N3OSi2 — CID 15084846
(3R,4S)-1-tert-butyl-4-pyridin-2-yl-3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)azetidin-2-one (PubChem CID 15084846) has the molecular formula C18H31N3OSi2 and a molecular weight of 361.64 g/mol. Its IUPAC name is (3R,4S)-1-tert-butyl-4-pyridin-2-yl-3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)azetidin-2-one.
| Compound Name | (3R,4S)-1-tert-butyl-4-pyridin-2-yl-3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)azetidin-2-one |
|---|---|
| PubChem CID | 15084846 |
| Molecular Formula | C18H31N3OSi2 |
| Molecular Weight | 361.64 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (3R,4S)-1-tert-butyl-4-pyridin-2-yl-3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)azetidin-2-one |
| SMILES | CC(C)(C)N1C(=O)[C@H](N2[Si](C)(C)CC[Si]2(C)C)[C@H]1c1ccccn1 |
| InChI | InChI=1S/C18H31N3OSi2/c1-18(2,3)20-15(14-10-8-9-11-19-14)16(17(20)22)21-23(4,5)12-13-24(21,6)7/h8-11,15-16H,12-13H2,1-7H3/t15-,16-/m1/s1 |
| InChIKey | SSFAPNHGRGALSN-HZPDHXFCSA-N |
| XLogP | 3.86 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.64 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|