About 2-cyclobutylethyl 3-oxopropanoate
2-cyclobutylethyl 3-oxopropanoate (PubChem CID 150850666) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-cyclobutylethyl 3-oxopropanoate.
Molecular Properties
| Compound Name | 2-cyclobutylethyl 3-oxopropanoate |
| PubChem CID | 150850666 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-cyclobutylethyl 3-oxopropanoate |
| SMILES | O=CCC(=O)OCCC1CCC1 |
| InChI | InChI=1S/C9H14O3/c10-6-4-9(11)12-7-5-8-2-1-3-8/h6,8H,1-5,7H2 |
| InChIKey | KPYOUDWLKHNAMR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclobutylethyl 3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylethyl 3-oxopropanoate?
The IUPAC name of 2-cyclobutylethyl 3-oxopropanoate (CID 150850666) is 2-cyclobutylethyl 3-oxopropanoate.
What is the SMILES notation for 2-cyclobutylethyl 3-oxopropanoate?
The canonical SMILES for 2-cyclobutylethyl 3-oxopropanoate is O=CCC(=O)OCCC1CCC1.
What is the InChIKey of 2-cyclobutylethyl 3-oxopropanoate?
The InChIKey is KPYOUDWLKHNAMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c10-6-4-9(11)12-7-5-8-2-1-3-8/h6,8H,1-5,7H2.
What are the key properties of 2-cyclobutylethyl 3-oxopropanoate?
2-cyclobutylethyl 3-oxopropanoate has a molecular weight of 170.21 g/mol, XLogP of 1.31, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylethyl 3-oxopropanoate is sourced from PubChem (CID 150850666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).