C28H37BClN3O7S — CID 150851905
[1-[[(2S)-1-[6-[4-[(4-chlorophenyl)sulfonylcarbamoyl]phenyl]-6-oxohexyl]pyrrolidine-2-carbonyl]amino]-2-methylpropyl]boronic acid (PubChem CID 150851905) has the molecular formula C28H37BClN3O7S and a molecular weight of 605.95 g/mol. Its IUPAC name is [1-[[(2S)-1-[6-[4-[(4-chlorophenyl)sulfonylcarbamoyl]phenyl]-6-oxohexyl]pyrrolidine-2-carbonyl]amino]-2-methylpropyl]boronic acid.
| Compound Name | [1-[[(2S)-1-[6-[4-[(4-chlorophenyl)sulfonylcarbamoyl]phenyl]-6-oxohexyl]pyrrolidine-2-carbonyl]amino]-2-methylpropyl]boronic acid |
|---|---|
| PubChem CID | 150851905 |
| Molecular Formula | C28H37BClN3O7S |
| Molecular Weight | 605.95 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | [1-[[(2S)-1-[6-[4-[(4-chlorophenyl)sulfonylcarbamoyl]phenyl]-6-oxohexyl]pyrrolidine-2-carbonyl]amino]-2-methylpropyl]boronic acid |
| SMILES | CC(C)C(NC(=O)[C@@H]1CCCN1CCCCCC(=O)c1ccc(C(=O)NS(=O)(=O)c2ccc(Cl)cc2)cc1)B(O)O |
| InChI | InChI=1S/C28H37BClN3O7S/c1-19(2)26(29(37)38)31-28(36)24-7-6-18-33(24)17-5-3-4-8-25(34)20-9-11-21(12-10-20)27(35)32-41(39,40)23-15-13-22(30)14-16-23/h9-16,19,24,26,37-38H,3-8,17-18H2,1-2H3,(H,31,36)(H,32,35)/t24-,26?/m0/s1 |
| InChIKey | KQEWJVBIXGXNTA-QSAPEBAKSA-N |
| XLogP | 2.82 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.95 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|