C14H11N5O2S — CID 15085566
10-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-8-methyl-3-thia-1,8,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-7-one (PubChem CID 15085566) has the molecular formula C14H11N5O2S and a molecular weight of 313.34 g/mol. Its IUPAC name is 10-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-8-methyl-3-thia-1,8,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-7-one.
| Compound Name | 10-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-8-methyl-3-thia-1,8,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 15085566 |
| Molecular Formula | C14H11N5O2S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 10-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-8-methyl-3-thia-1,8,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-7-one |
| SMILES | Cn1c(=O)c2ccsc2n2cnc(-c3noc(C4CC4)n3)c12 |
| InChI | InChI=1S/C14H11N5O2S/c1-18-12-9(10-16-11(21-17-10)7-2-3-7)15-6-19(12)14-8(13(18)20)4-5-22-14/h4-7H,2-3H2,1H3 |
| InChIKey | WKVTXYRWJXPGPH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |