C21H28O3 — CID 15085854
(6S,8S,13S,14S,17R)-17-acetyl-17-hydroxy-6,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 15085854) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (6S,8S,13S,14S,17R)-17-acetyl-17-hydroxy-6,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,13S,14S,17R)-17-acetyl-17-hydroxy-6,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 15085854 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (6S,8S,13S,14S,17R)-17-acetyl-17-hydroxy-6,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3C[C@H](C)C4=CC(=O)CCC4=C3CC[C@@]21C |
| InChI | InChI=1S/C21H28O3/c1-12-10-18-16(15-5-4-14(23)11-17(12)15)6-8-20(3)19(18)7-9-21(20,24)13(2)22/h11-12,18-19,24H,4-10H2,1-3H3/t12-,18+,19-,20-,21-/m0/s1 |
| InChIKey | CEMWJCOMZLCHCO-UKHBCRAOSA-N |
| XLogP | 3.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |