About N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide
N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide (PubChem CID 150859604) has the molecular formula C10H9F4N3O
and a molecular weight of 263.19 g/mol. Its IUPAC name is N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide.
Molecular Properties
| Compound Name | N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide |
| PubChem CID | 150859604 |
| Molecular Formula | C10H9F4N3O |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide |
| SMILES | O=C(N[C@@H](C1CC1)C(F)(F)F)c1cnc(F)cn1 |
| InChI | InChI=1S/C10H9F4N3O/c11-7-4-15-6(3-16-7)9(18)17-8(5-1-2-5)10(12,13)14/h3-5,8H,1-2H2,(H,17,18)/t8-/m0/s1 |
| InChIKey | KRSOILAQXHPMEK-QMMMGPOBSA-N |
| XLogP | 1.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide?
The IUPAC name of N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide (CID 150859604) is N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide.
What is the SMILES notation for N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide?
The canonical SMILES for N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide is O=C(N[C@@H](C1CC1)C(F)(F)F)c1cnc(F)cn1.
What is the InChIKey of N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide?
The InChIKey is KRSOILAQXHPMEK-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H9F4N3O/c11-7-4-15-6(3-16-7)9(18)17-8(5-1-2-5)10(12,13)14/h3-5,8H,1-2H2,(H,17,18)/t8-/m0/s1.
What are the key properties of N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide?
N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide has a molecular weight of 263.19 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-5-fluoropyrazine-2-carboxamide is sourced from PubChem (CID 150859604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).