C6H9F3O5S3 — CID 150861243
1,1-dioxo-3-(2,2,2-trifluoroethoxysulfonylsulfanyl)thiolane (PubChem CID 150861243) has the molecular formula C6H9F3O5S3 and a molecular weight of 314.33 g/mol. Its IUPAC name is 1,1-dioxo-3-(2,2,2-trifluoroethoxysulfonylsulfanyl)thiolane.
| Compound Name | 1,1-dioxo-3-(2,2,2-trifluoroethoxysulfonylsulfanyl)thiolane |
|---|---|
| PubChem CID | 150861243 |
| Molecular Formula | C6H9F3O5S3 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | 1,1-dioxo-3-(2,2,2-trifluoroethoxysulfonylsulfanyl)thiolane |
| SMILES | O=S1(=O)CCC(SS(=O)(=O)OCC(F)(F)F)C1 |
| InChI | InChI=1S/C6H9F3O5S3/c7-6(8,9)4-14-17(12,13)15-5-1-2-16(10,11)3-5/h5H,1-4H2 |
| InChIKey | KSBLYZFDRBIHIQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|