C41H80O4 — CID 150861460
2-[bis(10,10-dimethylundecoxy)methyl]undecyl prop-2-enoate (PubChem CID 150861460) has the molecular formula C41H80O4 and a molecular weight of 637.09 g/mol. Its IUPAC name is 2-[bis(10,10-dimethylundecoxy)methyl]undecyl prop-2-enoate.
| Compound Name | 2-[bis(10,10-dimethylundecoxy)methyl]undecyl prop-2-enoate |
|---|---|
| PubChem CID | 150861460 |
| Molecular Formula | C41H80O4 |
| Molecular Weight | 637.09 g/mol |
| Exact Mass | 636.61 |
| IUPAC Name | 2-[bis(10,10-dimethylundecoxy)methyl]undecyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(CCCCCCCCC)C(OCCCCCCCCCC(C)(C)C)OCCCCCCCCCC(C)(C)C |
| InChI | InChI=1S/C41H80O4/c1-9-11-12-13-16-21-26-31-37(36-45-38(42)10-2)39(43-34-29-24-19-14-17-22-27-32-40(3,4)5)44-35-30-25-20-15-18-23-28-33-41(6,7)8/h10,37,39H,2,9,11-36H2,1,3-8H3 |
| InChIKey | KSCQLPQHPGDYQA-UHFFFAOYSA-N |
| XLogP | 13.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.09 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|