About [carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid
[carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid (PubChem CID 150861581) has the molecular formula C13H17FN2O3S2
and a molecular weight of 332.42 g/mol. Its IUPAC name is [carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid.
Molecular Properties
| Compound Name | [carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid |
| PubChem CID | 150861581 |
| Molecular Formula | C13H17FN2O3S2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | [carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid |
| SMILES | CSc1c(C)cc(CN(SN(C)C(=O)O)C(=O)F)cc1C |
| InChI | InChI=1S/C13H17FN2O3S2/c1-8-5-10(6-9(2)11(8)20-4)7-16(12(14)17)21-15(3)13(18)19/h5-6H,7H2,1-4H3,(H,18,19) |
| InChIKey | KSDJQWSHVABGSE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid?
The IUPAC name of [carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid (CID 150861581) is [carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid.
What is the SMILES notation for [carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid?
The canonical SMILES for [carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid is CSc1c(C)cc(CN(SN(C)C(=O)O)C(=O)F)cc1C.
What is the InChIKey of [carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid?
The InChIKey is KSDJQWSHVABGSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FN2O3S2/c1-8-5-10(6-9(2)11(8)20-4)7-16(12(14)17)21-15(3)13(18)19/h5-6H,7H2,1-4H3,(H,18,19).
What are the key properties of [carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid?
[carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid has a molecular weight of 332.42 g/mol, XLogP of 4.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [carbonofluoridoyl-[(3,5-dimethyl-4-methylsulfanylphenyl)methyl]amino]sulfanyl-methylcarbamic acid is sourced from PubChem (CID 150861581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).