C11H13ClN2O4S — CID 150866577
3-chloro-5-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-2-methylpyridine-4-sulfonic acid (PubChem CID 150866577) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.76 g/mol. Its IUPAC name is 3-chloro-5-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-2-methylpyridine-4-sulfonic acid.
| Compound Name | 3-chloro-5-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-2-methylpyridine-4-sulfonic acid |
|---|---|
| PubChem CID | 150866577 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 3-chloro-5-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-2-methylpyridine-4-sulfonic acid |
| SMILES | Cc1ncc(C2=NOC(C)(C)C2)c(S(=O)(=O)O)c1Cl |
| InChI | InChI=1S/C11H13ClN2O4S/c1-6-9(12)10(19(15,16)17)7(5-13-6)8-4-11(2,3)18-14-8/h5H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | KTEHPEGWUAWEOU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|