About 5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one
5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one (PubChem CID 15086686) has the molecular formula C14H12Cl2O2
and a molecular weight of 283.15 g/mol. Its IUPAC name is 5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one.
Molecular Properties
| Compound Name | 5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one |
| PubChem CID | 15086686 |
| Molecular Formula | C14H12Cl2O2 |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one |
| SMILES | CC1(C)OC(/C=C/c2cc(Cl)cc(Cl)c2)=CC1=O |
| InChI | InChI=1S/C14H12Cl2O2/c1-14(2)13(17)8-12(18-14)4-3-9-5-10(15)7-11(16)6-9/h3-8H,1-2H3/b4-3+ |
| InChIKey | GPPNEALTHHZRSK-ONEGZZNKSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one?
The IUPAC name of 5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one (CID 15086686) is 5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one.
What is the SMILES notation for 5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one?
The canonical SMILES for 5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one is CC1(C)OC(/C=C/c2cc(Cl)cc(Cl)c2)=CC1=O.
What is the InChIKey of 5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one?
The InChIKey is GPPNEALTHHZRSK-ONEGZZNKSA-N. The full InChI is InChI=1S/C14H12Cl2O2/c1-14(2)13(17)8-12(18-14)4-3-9-5-10(15)7-11(16)6-9/h3-8H,1-2H3/b4-3+.
What are the key properties of 5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one?
5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one has a molecular weight of 283.15 g/mol, XLogP of 4.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-(3,5-dichlorophenyl)ethenyl]-2,2-dimethylfuran-3-one is sourced from PubChem (CID 15086686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).