About 5,9-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazepine
5,9-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazepine (PubChem CID 150874495) has the molecular formula C6H7N3O
and a molecular weight of 137.14 g/mol. Its IUPAC name is 5,9-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazepine.
Analyze 5,9-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,9-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazepine?
The IUPAC name of 5,9-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazepine (CID 150874495) is 5,9-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazepine.
What is the SMILES notation for 5,9-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazepine?
The canonical SMILES for 5,9-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazepine is C1=COCc2nncn2C1.
What is the InChIKey of 5,9-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazepine?
The InChIKey is KUSIHSFBMCOXQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O/c1-2-9-5-7-8-6(9)4-10-3-1/h1,3,5H,2,4H2.
What are the key properties of 5,9-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazepine?
5,9-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazepine has a molecular weight of 137.14 g/mol, XLogP of 0.32, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazepine is sourced from PubChem (CID 150874495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).