About 1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine
1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine (PubChem CID 15087733) has the molecular formula C24H32F2N2
and a molecular weight of 386.53 g/mol. Its IUPAC name is 1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine.
Molecular Properties
| Compound Name | 1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine |
| PubChem CID | 15087733 |
| Molecular Formula | C24H32F2N2 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine |
| SMILES | CC(C)C1CN(CCCCC(c2ccc(F)cc2)c2ccc(F)cc2)CCN1 |
| InChI | InChI=1S/C24H32F2N2/c1-18(2)24-17-28(16-14-27-24)15-4-3-5-23(19-6-10-21(25)11-7-19)20-8-12-22(26)13-9-20/h6-13,18,23-24,27H,3-5,14-17H2,1-2H3 |
| InChIKey | ALFMTTGMUUJHNG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine?
The IUPAC name of 1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine (CID 15087733) is 1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine.
What is the SMILES notation for 1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine?
The canonical SMILES for 1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine is CC(C)C1CN(CCCCC(c2ccc(F)cc2)c2ccc(F)cc2)CCN1.
What is the InChIKey of 1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine?
The InChIKey is ALFMTTGMUUJHNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32F2N2/c1-18(2)24-17-28(16-14-27-24)15-4-3-5-23(19-6-10-21(25)11-7-19)20-8-12-22(26)13-9-20/h6-13,18,23-24,27H,3-5,14-17H2,1-2H3.
What are the key properties of 1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine?
1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine has a molecular weight of 386.53 g/mol, XLogP of 5.20, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5,5-bis(4-fluorophenyl)pentyl]-3-propan-2-ylpiperazine is sourced from PubChem (CID 15087733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).