About 4-amino-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one
4-amino-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one (PubChem CID 15087818) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 4-amino-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one.
Analyze 4-amino-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one?
The IUPAC name of 4-amino-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one (CID 15087818) is 4-amino-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one.
What is the SMILES notation for 4-amino-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one?
The canonical SMILES for 4-amino-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one is Nc1cc(=O)[nH]c2c1CCC2.
What is the InChIKey of 4-amino-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one?
The InChIKey is BABNDIHHFOPOOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c9-6-4-8(11)10-7-3-1-2-5(6)7/h4H,1-3H2,(H3,9,10,11).
What are the key properties of 4-amino-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one?
4-amino-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one has a molecular weight of 150.18 g/mol, XLogP of 0.45, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one is sourced from PubChem (CID 15087818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).