C31H37BrF3N5O2Si — CID 150879483
(3R,5S)-1-benzyl-5-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidin-3-ol (PubChem CID 150879483) has the molecular formula C31H37BrF3N5O2Si and a molecular weight of 676.65 g/mol. Its IUPAC name is (3R,5S)-1-benzyl-5-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidin-3-ol.
| Compound Name | (3R,5S)-1-benzyl-5-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidin-3-ol |
|---|---|
| PubChem CID | 150879483 |
| Molecular Formula | C31H37BrF3N5O2Si |
| Molecular Weight | 676.65 g/mol |
| Exact Mass | 675.19 |
| IUPAC Name | (3R,5S)-1-benzyl-5-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidin-3-ol |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2nc(N[C@H]3C[C@@H](O)CN(Cc4ccccc4)C3)ncc2C(F)(F)F)c2ccc(Br)cc21 |
| InChI | InChI=1S/C31H37BrF3N5O2Si/c1-43(2,3)12-11-42-20-40-19-26(25-10-9-22(32)13-28(25)40)29-27(31(33,34)35)15-36-30(38-29)37-23-14-24(41)18-39(17-23)16-21-7-5-4-6-8-21/h4-10,13,15,19,23-24,41H,11-12,14,16-18,20H2,1-3H3,(H,36,37,38)/t23-,24+/m0/s1 |
| InChIKey | KVSCHCUTMAEDOO-BJKOFHAPSA-N |
| XLogP | 7.24 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.65 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|