About 2-bromopyrido[1,2-a]pyrimidin-4-one
2-bromopyrido[1,2-a]pyrimidin-4-one (PubChem CID 150886700) has the molecular formula C8H5BrN2O
and a molecular weight of 225.05 g/mol. Its IUPAC name is 2-bromopyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-bromopyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 150886700 |
| Molecular Formula | C8H5BrN2O |
| Molecular Weight | 225.05 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | 2-bromopyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(Br)nc2ccccn12 |
| InChI | InChI=1S/C8H5BrN2O/c9-6-5-8(12)11-4-2-1-3-7(11)10-6/h1-5H |
| InChIKey | KXDVJKUYEJNJMK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.05 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromopyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 2-bromopyrido[1,2-a]pyrimidin-4-one (CID 150886700) is 2-bromopyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 2-bromopyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 2-bromopyrido[1,2-a]pyrimidin-4-one is O=c1cc(Br)nc2ccccn12.
What is the InChIKey of 2-bromopyrido[1,2-a]pyrimidin-4-one?
The InChIKey is KXDVJKUYEJNJMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrN2O/c9-6-5-8(12)11-4-2-1-3-7(11)10-6/h1-5H.
What are the key properties of 2-bromopyrido[1,2-a]pyrimidin-4-one?
2-bromopyrido[1,2-a]pyrimidin-4-one has a molecular weight of 225.05 g/mol, XLogP of 1.46, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 150886700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).