C14H11BrClFN2O — CID 150887702
6-bromo-4-[(4-chloro-2-fluorophenyl)methyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine (PubChem CID 150887702) has the molecular formula C14H11BrClFN2O and a molecular weight of 357.61 g/mol. Its IUPAC name is 6-bromo-4-[(4-chloro-2-fluorophenyl)methyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine.
| Compound Name | 6-bromo-4-[(4-chloro-2-fluorophenyl)methyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 150887702 |
| Molecular Formula | C14H11BrClFN2O |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 6-bromo-4-[(4-chloro-2-fluorophenyl)methyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine |
| SMILES | Fc1cc(Cl)ccc1CN1CCOc2ccc(Br)nc21 |
| InChI | InChI=1S/C14H11BrClFN2O/c15-13-4-3-12-14(18-13)19(5-6-20-12)8-9-1-2-10(16)7-11(9)17/h1-4,7H,5-6,8H2 |
| InChIKey | KXJJFSADMPLSMS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|