C9H12F2O3 — CID 150887798
3,3-difluoro-5-hydroxy-4-(hydroxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-one (PubChem CID 150887798) has the molecular formula C9H12F2O3 and a molecular weight of 206.19 g/mol. Its IUPAC name is 3,3-difluoro-5-hydroxy-4-(hydroxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-one.
| Compound Name | 3,3-difluoro-5-hydroxy-4-(hydroxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 150887798 |
| Molecular Formula | C9H12F2O3 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 3,3-difluoro-5-hydroxy-4-(hydroxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-one |
| SMILES | O=C1CC2CC(O)C(CO)C2C1(F)F |
| InChI | InChI=1S/C9H12F2O3/c10-9(11)7(14)2-4-1-6(13)5(3-12)8(4)9/h4-6,8,12-13H,1-3H2 |
| InChIKey | KXJXAEUHRZIOTD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |