About 6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine
6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine (PubChem CID 150887851) has the molecular formula C24H28N2O
and a molecular weight of 360.50 g/mol. Its IUPAC name is 6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine |
| PubChem CID | 150887851 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine |
| SMILES | CC#C[C@@H](CC)c1ccc(OCc2ccc3ccn(CC(C)C)c3n2)cc1 |
| InChI | InChI=1S/C24H28N2O/c1-5-7-19(6-2)20-9-12-23(13-10-20)27-17-22-11-8-21-14-15-26(16-18(3)4)24(21)25-22/h8-15,18-19H,6,16-17H2,1-4H3/t19-/m1/s1 |
| InChIKey | KXKFFVHELNZRLR-LJQANCHMSA-N |
| XLogP | 5.79 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine?
The IUPAC name of 6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine (CID 150887851) is 6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine?
The canonical SMILES for 6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine is CC#C[C@@H](CC)c1ccc(OCc2ccc3ccn(CC(C)C)c3n2)cc1.
What is the InChIKey of 6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine?
The InChIKey is KXKFFVHELNZRLR-LJQANCHMSA-N. The full InChI is InChI=1S/C24H28N2O/c1-5-7-19(6-2)20-9-12-23(13-10-20)27-17-22-11-8-21-14-15-26(16-18(3)4)24(21)25-22/h8-15,18-19H,6,16-17H2,1-4H3/t19-/m1/s1.
What are the key properties of 6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine?
6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine has a molecular weight of 360.50 g/mol, XLogP of 5.79, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-1-(2-methylpropyl)pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 150887851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).