About 1,3,5-tritert-butylbenzene
1,3,5-tritert-butylbenzene (PubChem CID 15089) has the molecular formula C18H30
and a molecular weight of 246.44 g/mol. Its IUPAC name is 1,3,5-tritert-butylbenzene.
Molecular Properties
| Compound Name | 1,3,5-tritert-butylbenzene |
| PubChem CID | 15089 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 1,3,5-tritert-butylbenzene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H30/c1-16(2,3)13-10-14(17(4,5)6)12-15(11-13)18(7,8)9/h10-12H,1-9H3 |
| InChIKey | GUFMBISUSZUUCB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3,5-tritert-butylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-tritert-butylbenzene?
The IUPAC name of 1,3,5-tritert-butylbenzene (CID 15089) is 1,3,5-tritert-butylbenzene.
What is the SMILES notation for 1,3,5-tritert-butylbenzene?
The canonical SMILES for 1,3,5-tritert-butylbenzene is CC(C)(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1.
What is the InChIKey of 1,3,5-tritert-butylbenzene?
The InChIKey is GUFMBISUSZUUCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30/c1-16(2,3)13-10-14(17(4,5)6)12-15(11-13)18(7,8)9/h10-12H,1-9H3.
What are the key properties of 1,3,5-tritert-butylbenzene?
1,3,5-tritert-butylbenzene has a molecular weight of 246.44 g/mol, XLogP of 5.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-tritert-butylbenzene is sourced from PubChem (CID 15089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).