About 8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol
8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol (PubChem CID 150890523) has the molecular formula C20H23ClN2O3
and a molecular weight of 374.87 g/mol. Its IUPAC name is 8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol.
Molecular Properties
| Compound Name | 8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol |
| PubChem CID | 150890523 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol |
| SMILES | CC(C)(Cc1ccc(Cl)cc1)NCC(O)c1cc(O)cc2c1OC=CN2 |
| InChI | InChI=1S/C20H23ClN2O3/c1-20(2,11-13-3-5-14(21)6-4-13)23-12-18(25)16-9-15(24)10-17-19(16)26-8-7-22-17/h3-10,18,22-25H,11-12H2,1-2H3 |
| InChIKey | KXXWGTSYNCCQBC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol?
The IUPAC name of 8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol (CID 150890523) is 8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol.
What is the SMILES notation for 8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol?
The canonical SMILES for 8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol is CC(C)(Cc1ccc(Cl)cc1)NCC(O)c1cc(O)cc2c1OC=CN2.
What is the InChIKey of 8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol?
The InChIKey is KXXWGTSYNCCQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23ClN2O3/c1-20(2,11-13-3-5-14(21)6-4-13)23-12-18(25)16-9-15(24)10-17-19(16)26-8-7-22-17/h3-10,18,22-25H,11-12H2,1-2H3.
What are the key properties of 8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol?
8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol has a molecular weight of 374.87 g/mol, XLogP of 3.97, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-4H-1,4-benzoxazin-6-ol is sourced from PubChem (CID 150890523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).